C4ClF5N2O — CID 104632896
3-chloro-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-oxadiazole (PubChem CID 104632896) has the molecular formula C4ClF5N2O and a molecular weight of 222.50 g/mol. Its IUPAC name is 3-chloro-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-oxadiazole.
| Compound Name | 3-chloro-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 104632896 |
| Molecular Formula | C4ClF5N2O |
| Molecular Weight | 222.50 g/mol |
| Exact Mass | 221.96 |
| IUPAC Name | 3-chloro-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-oxadiazole |
| SMILES | FC(F)(F)C(F)(F)c1nc(Cl)no1 |
| InChI | InChI=1S/C4ClF5N2O/c5-2-11-1(13-12-2)3(6,7)4(8,9)10 |
| InChIKey | XDKPMHFNULYLLA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.50 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|