C7ClF10N3 — CID 122487872
2-chloro-4,6-bis(1,1,2,2,2-pentafluoroethyl)-1,3,5-triazine (PubChem CID 122487872) has the molecular formula C7ClF10N3 and a molecular weight of 351.53 g/mol. Its IUPAC name is 2-chloro-4,6-bis(1,1,2,2,2-pentafluoroethyl)-1,3,5-triazine.
| Compound Name | 2-chloro-4,6-bis(1,1,2,2,2-pentafluoroethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 122487872 |
| Molecular Formula | C7ClF10N3 |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 350.96 |
| IUPAC Name | 2-chloro-4,6-bis(1,1,2,2,2-pentafluoroethyl)-1,3,5-triazine |
| SMILES | FC(F)(F)C(F)(F)c1nc(Cl)nc(C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C7ClF10N3/c8-3-20-1(4(9,10)6(13,14)15)19-2(21-3)5(11,12)7(16,17)18 |
| InChIKey | ZAYVYRVPBPMAOX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|