C17H11ClN2O3S2 — CID 10524476
7-chloro-N-(phenylcarbamothioyl)thieno[2,3-f][1,3]benzodioxole-6-carboxamide (PubChem CID 10524476) has the molecular formula C17H11ClN2O3S2 and a molecular weight of 390.87 g/mol. Its IUPAC name is 7-chloro-N-(phenylcarbamothioyl)thieno[2,3-f][1,3]benzodioxole-6-carboxamide.
| Compound Name | 7-chloro-N-(phenylcarbamothioyl)thieno[2,3-f][1,3]benzodioxole-6-carboxamide |
|---|---|
| PubChem CID | 10524476 |
| Molecular Formula | C17H11ClN2O3S2 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 389.99 |
| IUPAC Name | 7-chloro-N-(phenylcarbamothioyl)thieno[2,3-f][1,3]benzodioxole-6-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccccc1)c1sc2cc3c(cc2c1Cl)OCO3 |
| InChI | InChI=1S/C17H11ClN2O3S2/c18-14-10-6-11-12(23-8-22-11)7-13(10)25-15(14)16(21)20-17(24)19-9-4-2-1-3-5-9/h1-7H,8H2,(H2,19,20,21,24) |
| InChIKey | JEQXFCOVALZZKI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|