C26H40O5Si2 — CID 10529042
(3R,4S,5R,6S)-5-[tert-butyl(diphenyl)silyl]oxy-6-(2-trimethylsilylethoxy)oxane-3,4-diol (PubChem CID 10529042) has the molecular formula C26H40O5Si2 and a molecular weight of 488.77 g/mol. Its IUPAC name is (3R,4S,5R,6S)-5-[tert-butyl(diphenyl)silyl]oxy-6-(2-trimethylsilylethoxy)oxane-3,4-diol.
| Compound Name | (3R,4S,5R,6S)-5-[tert-butyl(diphenyl)silyl]oxy-6-(2-trimethylsilylethoxy)oxane-3,4-diol |
|---|---|
| PubChem CID | 10529042 |
| Molecular Formula | C26H40O5Si2 |
| Molecular Weight | 488.77 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | (3R,4S,5R,6S)-5-[tert-butyl(diphenyl)silyl]oxy-6-(2-trimethylsilylethoxy)oxane-3,4-diol |
| SMILES | CC(C)(C)[Si](O[C@H]1[C@H](OCC[Si](C)(C)C)OC[C@@H](O)[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H40O5Si2/c1-26(2,3)33(20-13-9-7-10-14-20,21-15-11-8-12-16-21)31-24-23(28)22(27)19-30-25(24)29-17-18-32(4,5)6/h7-16,22-25,27-28H,17-19H2,1-6H3/t22-,23+,24-,25-/m1/s1 |
| InChIKey | HHHPSGNMTFKZSN-ZFFYZDHPSA-N |
| XLogP | 3.36 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.77 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|