C36H50O4Si — CID 10769460
[(1S)-1-[(5S,7aR)-5,7a-dimethyl-4-oxo-3-propan-2-yl-1,2,6,7-tetrahydroinden-5-yl]-4-[tert-butyl(diphenyl)silyl]oxybutyl] acetate (PubChem CID 10769460) has the molecular formula C36H50O4Si and a molecular weight of 574.88 g/mol. Its IUPAC name is [(1S)-1-[(5S,7aR)-5,7a-dimethyl-4-oxo-3-propan-2-yl-1,2,6,7-tetrahydroinden-5-yl]-4-[tert-butyl(diphenyl)silyl]oxybutyl] acetate.
| Compound Name | [(1S)-1-[(5S,7aR)-5,7a-dimethyl-4-oxo-3-propan-2-yl-1,2,6,7-tetrahydroinden-5-yl]-4-[tert-butyl(diphenyl)silyl]oxybutyl] acetate |
|---|---|
| PubChem CID | 10769460 |
| Molecular Formula | C36H50O4Si |
| Molecular Weight | 574.88 g/mol |
| Exact Mass | 574.35 |
| IUPAC Name | [(1S)-1-[(5S,7aR)-5,7a-dimethyl-4-oxo-3-propan-2-yl-1,2,6,7-tetrahydroinden-5-yl]-4-[tert-butyl(diphenyl)silyl]oxybutyl] acetate |
| SMILES | CC(=O)O[C@@H](CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@]1(C)CC[C@@]2(C)CCC(C(C)C)=C2C1=O |
| InChI | InChI=1S/C36H50O4Si/c1-26(2)30-21-22-35(7)23-24-36(8,33(38)32(30)35)31(40-27(3)37)20-15-25-39-41(34(4,5)6,28-16-11-9-12-17-28)29-18-13-10-14-19-29/h9-14,16-19,26,31H,15,20-25H2,1-8H3/t31-,35+,36-/m0/s1 |
| InChIKey | XSFUSJLTZCUOFM-NUHNATIRSA-N |
| XLogP | 7.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.88 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|