C20H31NO6S — CID 10873390
methyl 2-[2,2,6,6-tetramethyl-4-(4-methylphenyl)sulfonyloxy(115N)azinan-1-yl]oxypropanoate (PubChem CID 10873390) has the molecular formula C20H31NO6S and a molecular weight of 414.53 g/mol. Its IUPAC name is methyl 2-[2,2,6,6-tetramethyl-4-(4-methylphenyl)sulfonyloxy(115N)azinan-1-yl]oxypropanoate.
| Compound Name | methyl 2-[2,2,6,6-tetramethyl-4-(4-methylphenyl)sulfonyloxy(115N)azinan-1-yl]oxypropanoate |
|---|---|
| PubChem CID | 10873390 |
| Molecular Formula | C20H31NO6S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | methyl 2-[2,2,6,6-tetramethyl-4-(4-methylphenyl)sulfonyloxy(115N)azinan-1-yl]oxypropanoate |
| SMILES | COC(=O)C(C)O[15N]1C(C)(C)CC(OS(=O)(=O)c2ccc(C)cc2)CC1(C)C |
| InChI | InChI=1S/C20H31NO6S/c1-14-8-10-17(11-9-14)28(23,24)27-16-12-19(3,4)21(20(5,6)13-16)26-15(2)18(22)25-7/h8-11,15-16H,12-13H2,1-7H3/i21+1 |
| InChIKey | YFYQCQVUKJHDFK-ODHDQMIASA-N |
| XLogP | 3.22 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|