C21H38O9Si — CID 10874239
methyl (2R)-2-[(3aR,5S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(2-methoxy-2-oxoethyl)-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-2-methoxyacetate (PubChem CID 10874239) has the molecular formula C21H38O9Si and a molecular weight of 462.61 g/mol. Its IUPAC name is methyl (2R)-2-[(3aR,5S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(2-methoxy-2-oxoethyl)-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-2-methoxyacetate.
| Compound Name | methyl (2R)-2-[(3aR,5S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(2-methoxy-2-oxoethyl)-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-2-methoxyacetate |
|---|---|
| PubChem CID | 10874239 |
| Molecular Formula | C21H38O9Si |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | methyl (2R)-2-[(3aR,5S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(2-methoxy-2-oxoethyl)-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-2-methoxyacetate |
| SMILES | COC(=O)C[C@@]1(CO[Si](C)(C)C(C)(C)C)[C@@H]([C@@H](OC)C(=O)OC)O[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C21H38O9Si/c1-19(2,3)31(9,10)27-12-21(11-13(22)24-6)15(14(25-7)17(23)26-8)28-18-16(21)29-20(4,5)30-18/h14-16,18H,11-12H2,1-10H3/t14-,15-,16+,18-,21-/m1/s1 |
| InChIKey | KXVPZDFPQBGTLN-QQSMOKJMSA-N |
| XLogP | 2.62 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|