C20H22O5S2 — CID 10916532
(1S)-1-[(1S)-4,4-bis(benzenesulfonyl)-2-methylidenecyclopentyl]ethanol (PubChem CID 10916532) has the molecular formula C20H22O5S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is (1S)-1-[(1S)-4,4-bis(benzenesulfonyl)-2-methylidenecyclopentyl]ethanol.
| Compound Name | (1S)-1-[(1S)-4,4-bis(benzenesulfonyl)-2-methylidenecyclopentyl]ethanol |
|---|---|
| PubChem CID | 10916532 |
| Molecular Formula | C20H22O5S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | (1S)-1-[(1S)-4,4-bis(benzenesulfonyl)-2-methylidenecyclopentyl]ethanol |
| SMILES | C=C1CC(S(=O)(=O)c2ccccc2)(S(=O)(=O)c2ccccc2)C[C@@H]1[C@H](C)O |
| InChI | InChI=1S/C20H22O5S2/c1-15-13-20(14-19(15)16(2)21,26(22,23)17-9-5-3-6-10-17)27(24,25)18-11-7-4-8-12-18/h3-12,16,19,21H,1,13-14H2,2H3/t16-,19-/m0/s1 |
| InChIKey | NBXNNSYAEHKPBG-LPHOPBHVSA-N |
| XLogP | 2.98 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|