C24H42OSi2 — CID 10938295
trimethyl-[(3E,5E,7E,9E)-12-tri(propan-2-yl)silyloxydodeca-3,5,7,9-tetraen-1-ynyl]silane (PubChem CID 10938295) has the molecular formula C24H42OSi2 and a molecular weight of 402.77 g/mol. Its IUPAC name is trimethyl-[(3E,5E,7E,9E)-12-tri(propan-2-yl)silyloxydodeca-3,5,7,9-tetraen-1-ynyl]silane.
| Compound Name | trimethyl-[(3E,5E,7E,9E)-12-tri(propan-2-yl)silyloxydodeca-3,5,7,9-tetraen-1-ynyl]silane |
|---|---|
| PubChem CID | 10938295 |
| Molecular Formula | C24H42OSi2 |
| Molecular Weight | 402.77 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | trimethyl-[(3E,5E,7E,9E)-12-tri(propan-2-yl)silyloxydodeca-3,5,7,9-tetraen-1-ynyl]silane |
| SMILES | CC(C)[Si](OCC/C=C/C=C/C=C/C=C/C#C[Si](C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H42OSi2/c1-22(2)27(23(3)4,24(5)6)25-20-18-16-14-12-10-11-13-15-17-19-21-26(7,8)9/h10-17,22-24H,18,20H2,1-9H3/b12-10+,13-11+,16-14+,17-15+ |
| InChIKey | DJRYUMAWPIEOLG-MKFJXQSYSA-N |
| XLogP | 7.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.77 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|