C14H12Se2 — CID 10947725
9,10-diselenatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene (PubChem CID 10947725) has the molecular formula C14H12Se2 and a molecular weight of 338.17 g/mol. Its IUPAC name is 9,10-diselenatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene.
| Compound Name | 9,10-diselenatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene |
|---|---|
| PubChem CID | 10947725 |
| Molecular Formula | C14H12Se2 |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 339.93 |
| IUPAC Name | 9,10-diselenatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene |
| SMILES | c1ccc2c(c1)C[Se][Se]Cc1ccccc1-2 |
| InChI | InChI=1S/C14H12Se2/c1-3-7-13-11(5-1)9-15-16-10-12-6-2-4-8-14(12)13/h1-8H,9-10H2 |
| InChIKey | MHNLVOABRNYQNW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|