C29H42O6SSi — CID 10951718
tert-butyl-dimethyl-[(2R,3S)-2-[[(2R,3S)-2-(4-methylphenyl)sulfonyl-3-(phenylmethoxymethyl)oxiran-2-yl]methyl]oxan-3-yl]oxysilane (PubChem CID 10951718) has the molecular formula C29H42O6SSi and a molecular weight of 546.80 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2R,3S)-2-[[(2R,3S)-2-(4-methylphenyl)sulfonyl-3-(phenylmethoxymethyl)oxiran-2-yl]methyl]oxan-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2R,3S)-2-[[(2R,3S)-2-(4-methylphenyl)sulfonyl-3-(phenylmethoxymethyl)oxiran-2-yl]methyl]oxan-3-yl]oxysilane |
|---|---|
| PubChem CID | 10951718 |
| Molecular Formula | C29H42O6SSi |
| Molecular Weight | 546.80 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | tert-butyl-dimethyl-[(2R,3S)-2-[[(2R,3S)-2-(4-methylphenyl)sulfonyl-3-(phenylmethoxymethyl)oxiran-2-yl]methyl]oxan-3-yl]oxysilane |
| SMILES | Cc1ccc(S(=O)(=O)[C@@]2(C[C@H]3OCCC[C@@H]3O[Si](C)(C)C(C)(C)C)O[C@H]2COCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H42O6SSi/c1-22-14-16-24(17-15-22)36(30,31)29(27(34-29)21-32-20-23-11-8-7-9-12-23)19-26-25(13-10-18-33-26)35-37(5,6)28(2,3)4/h7-9,11-12,14-17,25-27H,10,13,18-21H2,1-6H3/t25-,26+,27-,29+/m0/s1 |
| InChIKey | FZPKROKPUZADOE-QPXUEMTLSA-N |
| XLogP | 6.04 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.80 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|