C25H35NO3S — CID 11015504
[[(4S)-2-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanyl-4,5-dihydro-1,3-oxazol-4-yl]-phenylmethyl] 2,2-dimethylpropanoate (PubChem CID 11015504) has the molecular formula C25H35NO3S and a molecular weight of 429.63 g/mol. Its IUPAC name is [[(4S)-2-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanyl-4,5-dihydro-1,3-oxazol-4-yl]-phenylmethyl] 2,2-dimethylpropanoate.
| Compound Name | [[(4S)-2-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanyl-4,5-dihydro-1,3-oxazol-4-yl]-phenylmethyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11015504 |
| Molecular Formula | C25H35NO3S |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | [[(4S)-2-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanyl-4,5-dihydro-1,3-oxazol-4-yl]-phenylmethyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)=CCC/C(C)=C/CSC1=N[C@H](C(OC(=O)C(C)(C)C)c2ccccc2)CO1 |
| InChI | InChI=1S/C25H35NO3S/c1-18(2)11-10-12-19(3)15-16-30-24-26-21(17-28-24)22(20-13-8-7-9-14-20)29-23(27)25(4,5)6/h7-9,11,13-15,21-22H,10,12,16-17H2,1-6H3/b19-15+/t21-,22?/m0/s1 |
| InChIKey | UPQVGZYKRFJVLW-AWPXZMOMSA-N |
| XLogP | 6.50 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|