C13H16ClNO5S2 — CID 110411790
3-(3-chlorophenyl)sulfonyl-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 110411790) has the molecular formula C13H16ClNO5S2 and a molecular weight of 365.86 g/mol. Its IUPAC name is 3-(3-chlorophenyl)sulfonyl-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 3-(3-chlorophenyl)sulfonyl-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 110411790 |
| Molecular Formula | C13H16ClNO5S2 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 3-(3-chlorophenyl)sulfonyl-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | O=C(CCS(=O)(=O)c1cccc(Cl)c1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H16ClNO5S2/c14-10-2-1-3-12(8-10)22(19,20)7-5-13(16)15-11-4-6-21(17,18)9-11/h1-3,8,11H,4-7,9H2,(H,15,16) |
| InChIKey | FBBILXSMKJANCC-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |