C19H28F2O2Si — CID 11046447
3-[tert-butyl(dimethyl)silyl]-2,2-difluoro-3-hydroxy-5-phenylcycloheptan-1-one (PubChem CID 11046447) has the molecular formula C19H28F2O2Si and a molecular weight of 354.51 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]-2,2-difluoro-3-hydroxy-5-phenylcycloheptan-1-one.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]-2,2-difluoro-3-hydroxy-5-phenylcycloheptan-1-one |
|---|---|
| PubChem CID | 11046447 |
| Molecular Formula | C19H28F2O2Si |
| Molecular Weight | 354.51 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]-2,2-difluoro-3-hydroxy-5-phenylcycloheptan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)C1(O)CC(c2ccccc2)CCC(=O)C1(F)F |
| InChI | InChI=1S/C19H28F2O2Si/c1-17(2,3)24(4,5)18(23)13-15(14-9-7-6-8-10-14)11-12-16(22)19(18,20)21/h6-10,15,23H,11-13H2,1-5H3 |
| InChIKey | KGBDKYXWPPUVIC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|