C26H50O5Si — CID 11091916
(2S,3S,6R,8S,9R)-2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-8-[(3R)-3-(hydroxymethyl)pentyl]-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-10-one (PubChem CID 11091916) has the molecular formula C26H50O5Si and a molecular weight of 470.77 g/mol. Its IUPAC name is (2S,3S,6R,8S,9R)-2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-8-[(3R)-3-(hydroxymethyl)pentyl]-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-10-one.
| Compound Name | (2S,3S,6R,8S,9R)-2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-8-[(3R)-3-(hydroxymethyl)pentyl]-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-10-one |
|---|---|
| PubChem CID | 11091916 |
| Molecular Formula | C26H50O5Si |
| Molecular Weight | 470.77 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | (2S,3S,6R,8S,9R)-2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-8-[(3R)-3-(hydroxymethyl)pentyl]-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-10-one |
| SMILES | CC[C@@H](CO)CC[C@@H]1O[C@]2(CC[C@H](C)[C@H](C[C@@H](C)O[Si](C)(C)C(C)(C)C)O2)CC(=O)[C@@H]1C |
| InChI | InChI=1S/C26H50O5Si/c1-10-21(17-27)11-12-23-20(4)22(28)16-26(29-23)14-13-18(2)24(30-26)15-19(3)31-32(8,9)25(5,6)7/h18-21,23-24,27H,10-17H2,1-9H3/t18-,19+,20-,21+,23-,24-,26-/m0/s1 |
| InChIKey | KTDITJOAQNJOJG-QOZYVPCJSA-N |
| XLogP | 6.09 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.77 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|