C30H40O6Si — CID 11168440
ethyl 2-[(1S,4R,6S)-1-(1,3-benzodioxol-5-yl)-4-[tert-butyl(dimethyl)silyl]oxy-6-phenylmethoxycyclohex-2-en-1-yl]acetate (PubChem CID 11168440) has the molecular formula C30H40O6Si and a molecular weight of 524.73 g/mol. Its IUPAC name is ethyl 2-[(1S,4R,6S)-1-(1,3-benzodioxol-5-yl)-4-[tert-butyl(dimethyl)silyl]oxy-6-phenylmethoxycyclohex-2-en-1-yl]acetate.
| Compound Name | ethyl 2-[(1S,4R,6S)-1-(1,3-benzodioxol-5-yl)-4-[tert-butyl(dimethyl)silyl]oxy-6-phenylmethoxycyclohex-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 11168440 |
| Molecular Formula | C30H40O6Si |
| Molecular Weight | 524.73 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | ethyl 2-[(1S,4R,6S)-1-(1,3-benzodioxol-5-yl)-4-[tert-butyl(dimethyl)silyl]oxy-6-phenylmethoxycyclohex-2-en-1-yl]acetate |
| SMILES | CCOC(=O)C[C@@]1(c2ccc3c(c2)OCO3)C=C[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H40O6Si/c1-7-32-28(31)19-30(23-13-14-25-26(17-23)35-21-34-25)16-15-24(36-37(5,6)29(2,3)4)18-27(30)33-20-22-11-9-8-10-12-22/h8-17,24,27H,7,18-21H2,1-6H3/t24-,27-,30+/m0/s1 |
| InChIKey | UGQAZYMPLGBSTR-GHVWSFOVSA-N |
| XLogP | 6.54 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.73 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|