C35H43NO6Si — CID 11169377
methyl (E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonyl-phenacylamino]pent-2-enoate (PubChem CID 11169377) has the molecular formula C35H43NO6Si and a molecular weight of 601.82 g/mol. Its IUPAC name is methyl (E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonyl-phenacylamino]pent-2-enoate.
| Compound Name | methyl (E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonyl-phenacylamino]pent-2-enoate |
|---|---|
| PubChem CID | 11169377 |
| Molecular Formula | C35H43NO6Si |
| Molecular Weight | 601.82 g/mol |
| Exact Mass | 601.29 |
| IUPAC Name | methyl (E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonyl-phenacylamino]pent-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N(CC(=O)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H43NO6Si/c1-34(2,3)42-33(39)36(25-31(37)27-17-11-8-12-18-27)28(23-24-32(38)40-7)26-41-43(35(4,5)6,29-19-13-9-14-20-29)30-21-15-10-16-22-30/h8-24,28H,25-26H2,1-7H3/b24-23+/t28-/m0/s1 |
| InChIKey | DLWZDTIVXBIQJD-LJOLIVRLSA-N |
| XLogP | 5.78 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.82 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|