C19H28FN5 — CID 111991193
2-[(5-cyano-2-fluorophenyl)methyl]-3-ethyl-1-[(1-ethylpyrrolidin-2-yl)methyl]-1-methylguanidine (PubChem CID 111991193) has the molecular formula C19H28FN5 and a molecular weight of 345.47 g/mol. Its IUPAC name is 2-[(5-cyano-2-fluorophenyl)methyl]-3-ethyl-1-[(1-ethylpyrrolidin-2-yl)methyl]-1-methylguanidine.
| Compound Name | 2-[(5-cyano-2-fluorophenyl)methyl]-3-ethyl-1-[(1-ethylpyrrolidin-2-yl)methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 111991193 |
| Molecular Formula | C19H28FN5 |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 2-[(5-cyano-2-fluorophenyl)methyl]-3-ethyl-1-[(1-ethylpyrrolidin-2-yl)methyl]-1-methylguanidine |
| SMILES | CCN/C(=N\Cc1cc(C#N)ccc1F)N(C)CC1CCCN1CC |
| InChI | InChI=1S/C19H28FN5/c1-4-22-19(24(3)14-17-7-6-10-25(17)5-2)23-13-16-11-15(12-21)8-9-18(16)20/h8-9,11,17H,4-7,10,13-14H2,1-3H3,(H,22,23) |
| InChIKey | AEONSCWKYDRMPP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 54.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|