C33H43NO6 — CID 11284256
tert-butyl N-benzyl-N-[(4R,5R,6S)-4,7-dihydroxy-5,6-bis(phenylmethoxy)heptyl]carbamate (PubChem CID 11284256) has the molecular formula C33H43NO6 and a molecular weight of 549.71 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[(4R,5R,6S)-4,7-dihydroxy-5,6-bis(phenylmethoxy)heptyl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[(4R,5R,6S)-4,7-dihydroxy-5,6-bis(phenylmethoxy)heptyl]carbamate |
|---|---|
| PubChem CID | 11284256 |
| Molecular Formula | C33H43NO6 |
| Molecular Weight | 549.71 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | tert-butyl N-benzyl-N-[(4R,5R,6S)-4,7-dihydroxy-5,6-bis(phenylmethoxy)heptyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCC[C@@H](O)[C@@H](OCc1ccccc1)[C@H](CO)OCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C33H43NO6/c1-33(2,3)40-32(37)34(22-26-14-7-4-8-15-26)21-13-20-29(36)31(39-25-28-18-11-6-12-19-28)30(23-35)38-24-27-16-9-5-10-17-27/h4-12,14-19,29-31,35-36H,13,20-25H2,1-3H3/t29-,30+,31-/m1/s1 |
| InChIKey | YPBLPHGGAQEHJQ-MJSOWUPRSA-N |
| XLogP | 5.73 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.71 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |