C27H52O6Si — CID 11318033
2-[(4S,6R)-2,2-dimethyl-6-[[(4R,5S,6S)-2,2,5-trimethyl-6-[2-tri(propan-2-yl)silyloxyethyl]-1,3-dioxan-4-yl]methyl]-1,3-dioxan-4-yl]acetaldehyde (PubChem CID 11318033) has the molecular formula C27H52O6Si and a molecular weight of 500.79 g/mol. Its IUPAC name is 2-[(4S,6R)-2,2-dimethyl-6-[[(4R,5S,6S)-2,2,5-trimethyl-6-[2-tri(propan-2-yl)silyloxyethyl]-1,3-dioxan-4-yl]methyl]-1,3-dioxan-4-yl]acetaldehyde.
| Compound Name | 2-[(4S,6R)-2,2-dimethyl-6-[[(4R,5S,6S)-2,2,5-trimethyl-6-[2-tri(propan-2-yl)silyloxyethyl]-1,3-dioxan-4-yl]methyl]-1,3-dioxan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 11318033 |
| Molecular Formula | C27H52O6Si |
| Molecular Weight | 500.79 g/mol |
| Exact Mass | 500.35 |
| IUPAC Name | 2-[(4S,6R)-2,2-dimethyl-6-[[(4R,5S,6S)-2,2,5-trimethyl-6-[2-tri(propan-2-yl)silyloxyethyl]-1,3-dioxan-4-yl]methyl]-1,3-dioxan-4-yl]acetaldehyde |
| SMILES | CC(C)[Si](OCC[C@@H]1OC(C)(C)O[C@H](C[C@H]2C[C@@H](CC=O)OC(C)(C)O2)[C@H]1C)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H52O6Si/c1-18(2)34(19(3)4,20(5)6)29-15-13-24-21(7)25(33-27(10,11)32-24)17-23-16-22(12-14-28)30-26(8,9)31-23/h14,18-25H,12-13,15-17H2,1-11H3/t21-,22+,23+,24-,25+/m0/s1 |
| InChIKey | DWCUVPOXGBGQQA-VCDBXAJLSA-N |
| XLogP | 6.61 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.79 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|