C30H44O4Si — CID 11329456
[(1R,2R,3S,5S)-3-[tert-butyl(diphenyl)silyl]oxy-5-[(2S)-2-(methoxymethoxy)pent-4-en-2-yl]-2-methylcyclopentyl]methanol (PubChem CID 11329456) has the molecular formula C30H44O4Si and a molecular weight of 496.76 g/mol. Its IUPAC name is [(1R,2R,3S,5S)-3-[tert-butyl(diphenyl)silyl]oxy-5-[(2S)-2-(methoxymethoxy)pent-4-en-2-yl]-2-methylcyclopentyl]methanol.
| Compound Name | [(1R,2R,3S,5S)-3-[tert-butyl(diphenyl)silyl]oxy-5-[(2S)-2-(methoxymethoxy)pent-4-en-2-yl]-2-methylcyclopentyl]methanol |
|---|---|
| PubChem CID | 11329456 |
| Molecular Formula | C30H44O4Si |
| Molecular Weight | 496.76 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | [(1R,2R,3S,5S)-3-[tert-butyl(diphenyl)silyl]oxy-5-[(2S)-2-(methoxymethoxy)pent-4-en-2-yl]-2-methylcyclopentyl]methanol |
| SMILES | C=CC[C@](C)(OCOC)[C@H]1C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](C)[C@H]1CO |
| InChI | InChI=1S/C30H44O4Si/c1-8-19-30(6,33-22-32-7)27-20-28(23(2)26(27)21-31)34-35(29(3,4)5,24-15-11-9-12-16-24)25-17-13-10-14-18-25/h8-18,23,26-28,31H,1,19-22H2,2-7H3/t23-,26-,27+,28+,30+/m1/s1 |
| InChIKey | YVIFQBXEZMYASJ-BGXFCQFZSA-N |
| XLogP | 5.15 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.76 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|