C43H68O2PSi2+ — CID 11343407
[(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-5-tri(propan-2-yl)silyloxyoct-6-enyl]-triphenylphosphanium (PubChem CID 11343407) has the molecular formula C43H68O2PSi2+ and a molecular weight of 704.16 g/mol. Its IUPAC name is [(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-5-tri(propan-2-yl)silyloxyoct-6-enyl]-triphenylphosphanium.
| Compound Name | [(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-5-tri(propan-2-yl)silyloxyoct-6-enyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 11343407 |
| Molecular Formula | C43H68O2PSi2+ |
| Molecular Weight | 704.16 g/mol |
| Exact Mass | 703.45 |
| IUPAC Name | [(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-5-tri(propan-2-yl)silyloxyoct-6-enyl]-triphenylphosphanium |
| SMILES | C/C=C/[C@H](O[Si](C(C)C)(C(C)C)C(C)C)C(C)(C)[C@H](CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C43H68O2PSi2/c1-15-25-40(45-48(34(2)3,35(4)5)36(6)7)43(11,12)41(44-47(13,14)42(8,9)10)32-33-46(37-26-19-16-20-27-37,38-28-21-17-22-29-38)39-30-23-18-24-31-39/h15-31,34-36,40-41H,32-33H2,1-14H3/q+1/b25-15+/t40-,41-/m0/s1 |
| InChIKey | FEPADFPVLWRQGD-MDOAYNSXSA-N |
| XLogP | 11.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.16 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|