C36H50IO3PSi — CID 11170048
[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-(5-methyl-2-methylidenehexoxy)-4-oxobutyl]-triphenylphosphanium iodide (PubChem CID 11170048) has the molecular formula C36H50IO3PSi and a molecular weight of 716.76 g/mol. Its IUPAC name is [(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-(5-methyl-2-methylidenehexoxy)-4-oxobutyl]-triphenylphosphanium iodide.
| Compound Name | [(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-(5-methyl-2-methylidenehexoxy)-4-oxobutyl]-triphenylphosphanium iodide |
|---|---|
| PubChem CID | 11170048 |
| Molecular Formula | C36H50IO3PSi |
| Molecular Weight | 716.76 g/mol |
| Exact Mass | 716.23 |
| IUPAC Name | [(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-(5-methyl-2-methylidenehexoxy)-4-oxobutyl]-triphenylphosphanium iodide |
| SMILES | C=C(CCC(C)C)COC(=O)[C@@H](CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)O[Si](C)(C)C(C)(C)C.[I-] |
| InChI | InChI=1S/C36H50O3PSi.HI/c1-29(2)24-25-30(3)28-38-35(37)34(39-41(7,8)36(4,5)6)26-27-40(31-18-12-9-13-19-31,32-20-14-10-15-21-32)33-22-16-11-17-23-33;/h9-23,29,34H,3,24-28H2,1-2,4-8H3;1H/q+1;/p-1/t34-;/m1./s1 |
| InChIKey | ZTGIJBLLSZSPEM-MDYNBEAQSA-M |
| XLogP | 5.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.76 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|