C17H36O5Si — CID 11473515
ethyl (2R,3R,4S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-4,6-dimethylheptanoate (PubChem CID 11473515) has the molecular formula C17H36O5Si and a molecular weight of 348.56 g/mol. Its IUPAC name is ethyl (2R,3R,4S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-4,6-dimethylheptanoate.
| Compound Name | ethyl (2R,3R,4S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-4,6-dimethylheptanoate |
|---|---|
| PubChem CID | 11473515 |
| Molecular Formula | C17H36O5Si |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | ethyl (2R,3R,4S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-4,6-dimethylheptanoate |
| SMILES | CCOC(=O)[C@H](O)[C@H](O)[C@@H](C)C[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H36O5Si/c1-9-21-16(20)15(19)14(18)13(3)10-12(2)11-22-23(7,8)17(4,5)6/h12-15,18-19H,9-11H2,1-8H3/t12-,13+,14-,15-/m1/s1 |
| InChIKey | DCVWGHMSAYQLHA-LXTVHRRPSA-N |
| XLogP | 2.96 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|