C23H26N3OP — CID 11574670
N-[2-[(2R,4S)-3-benzyl-2-hydroxy-1-phenyl-1,3,2-diazaphospholidin-4-yl]ethyl]aniline (PubChem CID 11574670) has the molecular formula C23H26N3OP and a molecular weight of 391.46 g/mol. Its IUPAC name is N-[2-[(2R,4S)-3-benzyl-2-hydroxy-1-phenyl-1,3,2-diazaphospholidin-4-yl]ethyl]aniline.
| Compound Name | N-[2-[(2R,4S)-3-benzyl-2-hydroxy-1-phenyl-1,3,2-diazaphospholidin-4-yl]ethyl]aniline |
|---|---|
| PubChem CID | 11574670 |
| Molecular Formula | C23H26N3OP |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | N-[2-[(2R,4S)-3-benzyl-2-hydroxy-1-phenyl-1,3,2-diazaphospholidin-4-yl]ethyl]aniline |
| SMILES | O[P@@]1N(c2ccccc2)C[C@H](CCNc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H26N3OP/c27-28-25(18-20-10-4-1-5-11-20)23(16-17-24-21-12-6-2-7-13-21)19-26(28)22-14-8-3-9-15-22/h1-15,23-24,27H,16-19H2/t23-,28+/m0/s1 |
| InChIKey | XOXGYLKAHOXZFO-NEKDWFFYSA-N |
| XLogP | 5.10 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|