C21H33BrO3Si — CID 11583027
2-bromo-6-[(1S,2R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-(2-methylprop-1-enyl)cyclopentyl]phenol (PubChem CID 11583027) has the molecular formula C21H33BrO3Si and a molecular weight of 441.48 g/mol. Its IUPAC name is 2-bromo-6-[(1S,2R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-(2-methylprop-1-enyl)cyclopentyl]phenol.
| Compound Name | 2-bromo-6-[(1S,2R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-(2-methylprop-1-enyl)cyclopentyl]phenol |
|---|---|
| PubChem CID | 11583027 |
| Molecular Formula | C21H33BrO3Si |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 2-bromo-6-[(1S,2R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-(2-methylprop-1-enyl)cyclopentyl]phenol |
| SMILES | CC(C)=C[C@@H]1[C@@H](c2cccc(Br)c2O)[C@H](O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H33BrO3Si/c1-13(2)11-15-18(25-26(6,7)21(3,4)5)12-17(23)19(15)14-9-8-10-16(22)20(14)24/h8-11,15,17-19,23-24H,12H2,1-7H3/t15-,17+,18+,19+/m0/s1 |
| InChIKey | XRZCYLDIAIUXDU-JCHJZTRSSA-N |
| XLogP | 5.98 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|