C20H31N5O10S — CID 11720743
[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl sulfamate;1,3,7-trimethylpurine-2,6-dione (PubChem CID 11720743) has the molecular formula C20H31N5O10S and a molecular weight of 533.56 g/mol. Its IUPAC name is [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl sulfamate;1,3,7-trimethylpurine-2,6-dione.
| Compound Name | [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl sulfamate;1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 11720743 |
| Molecular Formula | C20H31N5O10S |
| Molecular Weight | 533.56 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl sulfamate;1,3,7-trimethylpurine-2,6-dione |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[C@@]3(COS(N)(=O)=O)OC(C)(C)O[C@@H]23)O1.Cn1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C12H21NO8S.C8H10N4O2/c1-10(2)18-7-5-16-12(6-17-22(13,14)15)9(8(7)19-10)20-11(3,4)21-12;1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h7-9H,5-6H2,1-4H3,(H2,13,14,15);4H,1-3H3/t7-,8-,9+,12+;/m1./s1 |
| InChIKey | RKZUUQJGXLOZGP-WGAVTJJLSA-N |
| XLogP | -1.42 |
| TPSA | 177.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.56 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |