C18H34O3Si — CID 11738911
(2S,3S,4S,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-3-methyl-2-[(E)-prop-1-enyl]oxan-4-ol (PubChem CID 11738911) has the molecular formula C18H34O3Si and a molecular weight of 326.55 g/mol. Its IUPAC name is (2S,3S,4S,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-3-methyl-2-[(E)-prop-1-enyl]oxan-4-ol.
| Compound Name | (2S,3S,4S,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-3-methyl-2-[(E)-prop-1-enyl]oxan-4-ol |
|---|---|
| PubChem CID | 11738911 |
| Molecular Formula | C18H34O3Si |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | (2S,3S,4S,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-3-methyl-2-[(E)-prop-1-enyl]oxan-4-ol |
| SMILES | C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C[C@H](O)[C@H](C)[C@H](/C=C/C)O1 |
| InChI | InChI=1S/C18H34O3Si/c1-9-11-16-13(3)14(19)12-17(20-16)15(10-2)21-22(7,8)18(4,5)6/h9-11,13-17,19H,2,12H2,1,3-8H3/b11-9+/t13-,14-,15+,16-,17-/m0/s1 |
| InChIKey | ZPKPCOMRYVWLML-CMGLOFNDSA-N |
| XLogP | 4.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|