C19H18ClF2N3O4S — CID 118011704
4-[4-[(E)-3-[(N,N'-dimethylcarbamimidoyl)amino]-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]benzenesulfonyl chloride (PubChem CID 118011704) has the molecular formula C19H18ClF2N3O4S and a molecular weight of 457.89 g/mol. Its IUPAC name is 4-[4-[(E)-3-[(N,N'-dimethylcarbamimidoyl)amino]-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]benzenesulfonyl chloride.
| Compound Name | 4-[4-[(E)-3-[(N,N'-dimethylcarbamimidoyl)amino]-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 118011704 |
| Molecular Formula | C19H18ClF2N3O4S |
| Molecular Weight | 457.89 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | 4-[4-[(E)-3-[(N,N'-dimethylcarbamimidoyl)amino]-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]benzenesulfonyl chloride |
| SMILES | C/N=C(\NC)NC(=O)/C(C)=C/c1cc(F)c(Oc2ccc(S(=O)(=O)Cl)cc2)c(F)c1 |
| InChI | InChI=1S/C19H18ClF2N3O4S/c1-11(18(26)25-19(23-2)24-3)8-12-9-15(21)17(16(22)10-12)29-13-4-6-14(7-5-13)30(20,27)28/h4-10H,1-3H3,(H2,23,24,25,26)/b11-8+ |
| InChIKey | DMNUNXVUMKDIOX-DHZHZOJOSA-N |
| XLogP | 3.41 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.89 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|