C24H42NO4P — CID 11812219
diethyl [1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-3,4-dihydro-2H-pyridin-6-yl] phosphate (PubChem CID 11812219) has the molecular formula C24H42NO4P and a molecular weight of 439.58 g/mol. Its IUPAC name is diethyl [1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-3,4-dihydro-2H-pyridin-6-yl] phosphate.
| Compound Name | diethyl [1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-3,4-dihydro-2H-pyridin-6-yl] phosphate |
|---|---|
| PubChem CID | 11812219 |
| Molecular Formula | C24H42NO4P |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | diethyl [1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-3,4-dihydro-2H-pyridin-6-yl] phosphate |
| SMILES | CCOP(=O)(OCC)OC1=CCCCN1C/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C24H42NO4P/c1-7-27-30(26,28-8-2)29-24-17-9-10-19-25(24)20-18-23(6)16-12-15-22(5)14-11-13-21(3)4/h13,15,17-18H,7-12,14,16,19-20H2,1-6H3/b22-15+,23-18+ |
| InChIKey | KXVKDRLHINVXIS-IKLLWGIXSA-N |
| XLogP | 7.54 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|