C35H53NO9 — CID 118157211
(2S)-2-[(E,11S)-1-[[(2S)-1-(4-but-2-ynoxyphenyl)-3-hydroxypropan-2-yl]amino]-11-hydroxy-1-oxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid (PubChem CID 118157211) has the molecular formula C35H53NO9 and a molecular weight of 631.81 g/mol. Its IUPAC name is (2S)-2-[(E,11S)-1-[[(2S)-1-(4-but-2-ynoxyphenyl)-3-hydroxypropan-2-yl]amino]-11-hydroxy-1-oxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid.
| Compound Name | (2S)-2-[(E,11S)-1-[[(2S)-1-(4-but-2-ynoxyphenyl)-3-hydroxypropan-2-yl]amino]-11-hydroxy-1-oxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 118157211 |
| Molecular Formula | C35H53NO9 |
| Molecular Weight | 631.81 g/mol |
| Exact Mass | 631.37 |
| IUPAC Name | (2S)-2-[(E,11S)-1-[[(2S)-1-(4-but-2-ynoxyphenyl)-3-hydroxypropan-2-yl]amino]-11-hydroxy-1-oxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
| SMILES | CC#CCOc1ccc(C[C@@H](CO)NC(=O)C(/C=C/CCCCCC[C@@H](O)CCCCCCC)[C@@](O)(CC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C35H53NO9/c1-3-5-7-10-13-16-29(38)17-14-11-8-9-12-15-18-31(35(44,34(42)43)25-32(39)40)33(41)36-28(26-37)24-27-19-21-30(22-20-27)45-23-6-4-2/h15,18-22,28-29,31,37-38,44H,3,5,7-14,16-17,23-26H2,1-2H3,(H,36,41)(H,39,40)(H,42,43)/b18-15+/t28-,29-,31?,35-/m0/s1 |
| InChIKey | PXFMLBVCPJJZPQ-PHHFFSCNSA-N |
| XLogP | 4.63 |
| TPSA | 173.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.81 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|