C26H25F8NO6S2 — CID 118217925
[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-(4-methoxy-1,1-dioxothian-4-yl)methanone (PubChem CID 118217925) has the molecular formula C26H25F8NO6S2 and a molecular weight of 663.61 g/mol. Its IUPAC name is [(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-(4-methoxy-1,1-dioxothian-4-yl)methanone.
| Compound Name | [(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-(4-methoxy-1,1-dioxothian-4-yl)methanone |
|---|---|
| PubChem CID | 118217925 |
| Molecular Formula | C26H25F8NO6S2 |
| Molecular Weight | 663.61 g/mol |
| Exact Mass | 663.10 |
| IUPAC Name | [(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-(4-methoxy-1,1-dioxothian-4-yl)methanone |
| SMILES | COC1(C(=O)N2CC[C@](c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C26H25F8NO6S2/c1-41-22(11-14-42(37,38)15-12-22)21(36)35-13-10-23(16-35,43(39,40)20-8-6-19(27)7-9-20)17-2-4-18(5-3-17)24(28,25(29,30)31)26(32,33)34/h2-9H,10-16H2,1H3/t23-/m0/s1 |
| InChIKey | HPMPPPHFZHTUEW-QHCPKHFHSA-N |
| XLogP | 4.61 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |