C26H26F8N2O5S2 — CID 118217927
[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-(1-methylsulfonylpiperidin-4-yl)methanone (PubChem CID 118217927) has the molecular formula C26H26F8N2O5S2 and a molecular weight of 662.62 g/mol. Its IUPAC name is [(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-(1-methylsulfonylpiperidin-4-yl)methanone.
| Compound Name | [(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-(1-methylsulfonylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 118217927 |
| Molecular Formula | C26H26F8N2O5S2 |
| Molecular Weight | 662.62 g/mol |
| Exact Mass | 662.12 |
| IUPAC Name | [(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-(1-methylsulfonylpiperidin-4-yl)methanone |
| SMILES | CS(=O)(=O)N1CCC(C(=O)N2CC[C@](c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C26H26F8N2O5S2/c1-42(38,39)36-13-10-17(11-14-36)22(37)35-15-12-23(16-35,43(40,41)21-8-6-20(27)7-9-21)18-2-4-19(5-3-18)24(28,25(29,30)31)26(32,33)34/h2-9,17H,10-16H2,1H3/t23-/m0/s1 |
| InChIKey | WHXSTZQJSMXRER-QHCPKHFHSA-N |
| XLogP | 4.69 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |