C26H32N4O2 — CID 118358698
1-[(3E,5E)-3-[[4-(dimethylamino)phenyl]methylidene]-5-[[4-(methylaminomethyl)phenyl]methylidene]-4-oxocyclohexyl]-3-methylurea (PubChem CID 118358698) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 1-[(3E,5E)-3-[[4-(dimethylamino)phenyl]methylidene]-5-[[4-(methylaminomethyl)phenyl]methylidene]-4-oxocyclohexyl]-3-methylurea.
| Compound Name | 1-[(3E,5E)-3-[[4-(dimethylamino)phenyl]methylidene]-5-[[4-(methylaminomethyl)phenyl]methylidene]-4-oxocyclohexyl]-3-methylurea |
|---|---|
| PubChem CID | 118358698 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 1-[(3E,5E)-3-[[4-(dimethylamino)phenyl]methylidene]-5-[[4-(methylaminomethyl)phenyl]methylidene]-4-oxocyclohexyl]-3-methylurea |
| SMILES | CNCc1ccc(/C=C2\CC(NC(=O)NC)C/C(=C\c3ccc(N(C)C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H32N4O2/c1-27-17-20-7-5-18(6-8-20)13-21-15-23(29-26(32)28-2)16-22(25(21)31)14-19-9-11-24(12-10-19)30(3)4/h5-14,23,27H,15-17H2,1-4H3,(H2,28,29,32)/b21-13+,22-14+ |
| InChIKey | DYFZDMUQMYHEJT-JFMUQQRKSA-N |
| XLogP | 3.60 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|