C6H12N4O2 — CID 118673118
(2R,5S)-4-azido-5-(methoxymethyl)oxolan-2-amine (PubChem CID 118673118) has the molecular formula C6H12N4O2 and a molecular weight of 172.19 g/mol. Its IUPAC name is (2R,5S)-4-azido-5-(methoxymethyl)oxolan-2-amine.
| Compound Name | (2R,5S)-4-azido-5-(methoxymethyl)oxolan-2-amine |
|---|---|
| PubChem CID | 118673118 |
| Molecular Formula | C6H12N4O2 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | (2R,5S)-4-azido-5-(methoxymethyl)oxolan-2-amine |
| SMILES | COC[C@H]1O[C@@H](N)CC1N=[N+]=[N-] |
| InChI | InChI=1S/C6H12N4O2/c1-11-3-5-4(9-10-8)2-6(7)12-5/h4-6H,2-3,7H2,1H3/t4?,5-,6-/m1/s1 |
| InChIKey | SZGSXQNHNCJDGB-YSLANXFLSA-N |
| XLogP | 0.39 |
| TPSA | 93.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|