C6H7N3O2 — CID 118973903
(6E)-6-[(methylideneamino)methylidene]-1,3-diazinane-2,4-dione (PubChem CID 118973903) has the molecular formula C6H7N3O2 and a molecular weight of 153.14 g/mol. Its IUPAC name is (6E)-6-[(methylideneamino)methylidene]-1,3-diazinane-2,4-dione.
| Compound Name | (6E)-6-[(methylideneamino)methylidene]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 118973903 |
| Molecular Formula | C6H7N3O2 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.05 |
| IUPAC Name | (6E)-6-[(methylideneamino)methylidene]-1,3-diazinane-2,4-dione |
| SMILES | C=N/C=C1\CC(=O)NC(=O)N1 |
| InChI | InChI=1S/C6H7N3O2/c1-7-3-4-2-5(10)9-6(11)8-4/h3H,1-2H2,(H2,8,9,10,11)/b4-3+ |
| InChIKey | UWSGBMVDYLDYKJ-ONEGZZNKSA-N |
| XLogP | -0.24 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|