C23H42N2O6 — CID 121443967
[(2S)-1-[[(3S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentan-3-yl]amino]-1-oxopentan-2-yl] octanoate (PubChem CID 121443967) has the molecular formula C23H42N2O6 and a molecular weight of 442.60 g/mol. Its IUPAC name is [(2S)-1-[[(3S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentan-3-yl]amino]-1-oxopentan-2-yl] octanoate.
| Compound Name | [(2S)-1-[[(3S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentan-3-yl]amino]-1-oxopentan-2-yl] octanoate |
|---|---|
| PubChem CID | 121443967 |
| Molecular Formula | C23H42N2O6 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.30 |
| IUPAC Name | [(2S)-1-[[(3S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentan-3-yl]amino]-1-oxopentan-2-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@@H](CCC)C(=O)N[C@@H](CCNC(=O)OC(C)(C)C)C(C)=O |
| InChI | InChI=1S/C23H42N2O6/c1-7-9-10-11-12-14-20(27)30-19(13-8-2)21(28)25-18(17(3)26)15-16-24-22(29)31-23(4,5)6/h18-19H,7-16H2,1-6H3,(H,24,29)(H,25,28)/t18-,19-/m0/s1 |
| InChIKey | GZUFCWTYKUYMRY-OALUTQOASA-N |
| XLogP | 4.05 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|