C15H20N2O4S — CID 122366009
(4R,5S)-4-methoxy-5,7-dimethyl-6-(4-methylphenyl)sulfonyl-1,3,4,5-tetrahydro-1,3-diazepin-2-one (PubChem CID 122366009) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is (4R,5S)-4-methoxy-5,7-dimethyl-6-(4-methylphenyl)sulfonyl-1,3,4,5-tetrahydro-1,3-diazepin-2-one.
| Compound Name | (4R,5S)-4-methoxy-5,7-dimethyl-6-(4-methylphenyl)sulfonyl-1,3,4,5-tetrahydro-1,3-diazepin-2-one |
|---|---|
| PubChem CID | 122366009 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | (4R,5S)-4-methoxy-5,7-dimethyl-6-(4-methylphenyl)sulfonyl-1,3,4,5-tetrahydro-1,3-diazepin-2-one |
| SMILES | CO[C@H]1NC(=O)NC(C)=C(S(=O)(=O)c2ccc(C)cc2)[C@H]1C |
| InChI | InChI=1S/C15H20N2O4S/c1-9-5-7-12(8-6-9)22(19,20)13-10(2)14(21-4)17-15(18)16-11(13)3/h5-8,10,14H,1-4H3,(H2,16,17,18)/t10-,14-/m1/s1 |
| InChIKey | IJOABBCALHWVIK-QMTHXVAHSA-N |
| XLogP | 1.92 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |