C29H56O3Si2 — CID 122392521
(2E,6S,7S,8E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-6-tri(propan-2-yl)silyloxydodeca-2,8,10-trienal (PubChem CID 122392521) has the molecular formula C29H56O3Si2 and a molecular weight of 508.94 g/mol. Its IUPAC name is (2E,6S,7S,8E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-6-tri(propan-2-yl)silyloxydodeca-2,8,10-trienal.
| Compound Name | (2E,6S,7S,8E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-6-tri(propan-2-yl)silyloxydodeca-2,8,10-trienal |
|---|---|
| PubChem CID | 122392521 |
| Molecular Formula | C29H56O3Si2 |
| Molecular Weight | 508.94 g/mol |
| Exact Mass | 508.38 |
| IUPAC Name | (2E,6S,7S,8E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-6-tri(propan-2-yl)silyloxydodeca-2,8,10-trienal |
| SMILES | C/C(=C\C=O)CC[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)/C=C/C=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H56O3Si2/c1-23(2)34(24(3)4,25(5)6)32-28(19-18-26(7)20-21-30)27(8)17-15-14-16-22-31-33(12,13)29(9,10)11/h14-17,20-21,23-25,27-28H,18-19,22H2,1-13H3/b16-14+,17-15+,26-20+/t27-,28-/m0/s1 |
| InChIKey | NWLYFCHLOQDCCF-ZUXWKEEPSA-N |
| XLogP | 9.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.94 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|