C18H12N6O4 — CID 122417896
4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)-pyridin-2-ylamino]benzamide (PubChem CID 122417896) has the molecular formula C18H12N6O4 and a molecular weight of 376.33 g/mol. Its IUPAC name is 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)-pyridin-2-ylamino]benzamide.
| Compound Name | 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)-pyridin-2-ylamino]benzamide |
|---|---|
| PubChem CID | 122417896 |
| Molecular Formula | C18H12N6O4 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)-pyridin-2-ylamino]benzamide |
| SMILES | NC(=O)c1ccc(N(c2ccccn2)c2ccc([N+](=O)[O-])c3nonc23)cc1 |
| InChI | InChI=1S/C18H12N6O4/c19-18(25)11-4-6-12(7-5-11)23(15-3-1-2-10-20-15)13-8-9-14(24(26)27)17-16(13)21-28-22-17/h1-10H,(H2,19,25) |
| InChIKey | QNEPGHCMTBBMGN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|