C20H21ClFN5O2 — CID 122422251
2-(azetidin-3-yl)-4-N-(3-chloro-4-fluorophenyl)-7-(2-methoxyethoxy)quinazoline-4,6-diamine (PubChem CID 122422251) has the molecular formula C20H21ClFN5O2 and a molecular weight of 417.87 g/mol. Its IUPAC name is 2-(azetidin-3-yl)-4-N-(3-chloro-4-fluorophenyl)-7-(2-methoxyethoxy)quinazoline-4,6-diamine.
| Compound Name | 2-(azetidin-3-yl)-4-N-(3-chloro-4-fluorophenyl)-7-(2-methoxyethoxy)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 122422251 |
| Molecular Formula | C20H21ClFN5O2 |
| Molecular Weight | 417.87 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-(azetidin-3-yl)-4-N-(3-chloro-4-fluorophenyl)-7-(2-methoxyethoxy)quinazoline-4,6-diamine |
| SMILES | COCCOc1cc2nc(C3CNC3)nc(Nc3ccc(F)c(Cl)c3)c2cc1N |
| InChI | InChI=1S/C20H21ClFN5O2/c1-28-4-5-29-18-8-17-13(7-16(18)23)20(27-19(26-17)11-9-24-10-11)25-12-2-3-15(22)14(21)6-12/h2-3,6-8,11,24H,4-5,9-10,23H2,1H3,(H,25,26,27) |
| InChIKey | RNDOPGFYCHEYCE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.87 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|