C21H25N5O3S — CID 122580827
3-[2-(phenyliminohydrazinylidene)-3-(2,4,6-trimethylphenyl)imidazol-1-yl]propane-1-sulfonic acid (PubChem CID 122580827) has the molecular formula C21H25N5O3S and a molecular weight of 427.53 g/mol. Its IUPAC name is 3-[2-(phenyliminohydrazinylidene)-3-(2,4,6-trimethylphenyl)imidazol-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-(phenyliminohydrazinylidene)-3-(2,4,6-trimethylphenyl)imidazol-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 122580827 |
| Molecular Formula | C21H25N5O3S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 3-[2-(phenyliminohydrazinylidene)-3-(2,4,6-trimethylphenyl)imidazol-1-yl]propane-1-sulfonic acid |
| SMILES | Cc1cc(C)c(-n2ccn(CCCS(=O)(=O)O)c2=N/N=N/c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C21H25N5O3S/c1-16-14-17(2)20(18(3)15-16)26-12-11-25(10-7-13-30(27,28)29)21(26)23-24-22-19-8-5-4-6-9-19/h4-6,8-9,11-12,14-15H,7,10,13H2,1-3H3,(H,27,28,29)/b23-21?,24-22+ |
| InChIKey | QWVKFNZBSQNVRN-MYMSFJRLSA-N |
| XLogP | 4.08 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|