C24H37BrN4O4 — CID 123141600
2-[[amino-[[2-(2-bromo-4,5-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-(2-methylpropyl)propanamide (PubChem CID 123141600) has the molecular formula C24H37BrN4O4 and a molecular weight of 525.49 g/mol. Its IUPAC name is 2-[[amino-[[2-(2-bromo-4,5-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-(2-methylpropyl)propanamide.
| Compound Name | 2-[[amino-[[2-(2-bromo-4,5-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 123141600 |
| Molecular Formula | C24H37BrN4O4 |
| Molecular Weight | 525.49 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | 2-[[amino-[[2-(2-bromo-4,5-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-(2-methylpropyl)propanamide |
| SMILES | COc1cc(Br)c(CC(=O)N/C(N)=N/C(CC2CCCCC2)C(=O)NCC(C)C)cc1OC |
| InChI | InChI=1S/C24H37BrN4O4/c1-15(2)14-27-23(31)19(10-16-8-6-5-7-9-16)28-24(26)29-22(30)12-17-11-20(32-3)21(33-4)13-18(17)25/h11,13,15-16,19H,5-10,12,14H2,1-4H3,(H,27,31)(H3,26,28,29,30) |
| InChIKey | KBGMUZPSOLDEDE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|