C29H40BrN5O6S — CID 138723472
(2R)-2-[[amino-[[2-(2-bromo-4,5-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[5-(dimethylsulfamoyl)-2-methylphenyl]propanamide (PubChem CID 138723472) has the molecular formula C29H40BrN5O6S and a molecular weight of 666.64 g/mol. Its IUPAC name is (2R)-2-[[amino-[[2-(2-bromo-4,5-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[5-(dimethylsulfamoyl)-2-methylphenyl]propanamide.
| Compound Name | (2R)-2-[[amino-[[2-(2-bromo-4,5-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[5-(dimethylsulfamoyl)-2-methylphenyl]propanamide |
|---|---|
| PubChem CID | 138723472 |
| Molecular Formula | C29H40BrN5O6S |
| Molecular Weight | 666.64 g/mol |
| Exact Mass | 665.19 |
| IUPAC Name | (2R)-2-[[amino-[[2-(2-bromo-4,5-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[5-(dimethylsulfamoyl)-2-methylphenyl]propanamide |
| SMILES | COc1cc(Br)c(CC(=O)N/C(N)=N/[C@H](CC2CCCCC2)C(=O)Nc2cc(S(=O)(=O)N(C)C)ccc2C)cc1OC |
| InChI | InChI=1S/C29H40BrN5O6S/c1-18-11-12-21(42(38,39)35(2)3)16-23(18)32-28(37)24(13-19-9-7-6-8-10-19)33-29(31)34-27(36)15-20-14-25(40-4)26(41-5)17-22(20)30/h11-12,14,16-17,19,24H,6-10,13,15H2,1-5H3,(H,32,37)(H3,31,33,34,36)/t24-/m1/s1 |
| InChIKey | VRLXZTCENARZMR-XMMPIXPASA-N |
| XLogP | 3.98 |
| TPSA | 152.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.64 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|