C25H34N6O7S — CID 162647613
(2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-(2-methyl-5-sulfamoylphenyl)-3-morpholin-4-ylpropanamide (PubChem CID 162647613) has the molecular formula C25H34N6O7S and a molecular weight of 562.65 g/mol. Its IUPAC name is (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-(2-methyl-5-sulfamoylphenyl)-3-morpholin-4-ylpropanamide.
| Compound Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-(2-methyl-5-sulfamoylphenyl)-3-morpholin-4-ylpropanamide |
|---|---|
| PubChem CID | 162647613 |
| Molecular Formula | C25H34N6O7S |
| Molecular Weight | 562.65 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-(2-methyl-5-sulfamoylphenyl)-3-morpholin-4-ylpropanamide |
| SMILES | COc1ccc(CC(=O)N/C(N)=N/[C@H](CN2CCOCC2)C(=O)Nc2cc(S(N)(=O)=O)ccc2C)cc1OC |
| InChI | InChI=1S/C25H34N6O7S/c1-16-4-6-18(39(27,34)35)14-19(16)28-24(33)20(15-31-8-10-38-11-9-31)29-25(26)30-23(32)13-17-5-7-21(36-2)22(12-17)37-3/h4-7,12,14,20H,8-11,13,15H2,1-3H3,(H,28,33)(H2,27,34,35)(H3,26,29,30,32)/t20-/m1/s1 |
| InChIKey | HTBZREBNLVRBRR-HXUWFJFHSA-N |
| XLogP | -0.03 |
| TPSA | 187.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.65 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|