C31H44N6O6S — CID 138723658
(2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-(2-methyl-5-piperazin-1-ylsulfonylphenyl)propanamide (PubChem CID 138723658) has the molecular formula C31H44N6O6S and a molecular weight of 628.80 g/mol. Its IUPAC name is (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-(2-methyl-5-piperazin-1-ylsulfonylphenyl)propanamide.
| Compound Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-(2-methyl-5-piperazin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 138723658 |
| Molecular Formula | C31H44N6O6S |
| Molecular Weight | 628.80 g/mol |
| Exact Mass | 628.30 |
| IUPAC Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-(2-methyl-5-piperazin-1-ylsulfonylphenyl)propanamide |
| SMILES | COc1ccc(CC(=O)N/C(N)=N/[C@H](CC2CCCCC2)C(=O)Nc2cc(S(=O)(=O)N3CCNCC3)ccc2C)cc1OC |
| InChI | InChI=1S/C31H44N6O6S/c1-21-9-11-24(44(40,41)37-15-13-33-14-16-37)20-25(21)34-30(39)26(17-22-7-5-4-6-8-22)35-31(32)36-29(38)19-23-10-12-27(42-2)28(18-23)43-3/h9-12,18,20,22,26,33H,4-8,13-17,19H2,1-3H3,(H,34,39)(H3,32,35,36,38)/t26-/m1/s1 |
| InChIKey | CCJQESJICROEBW-AREMUKBSSA-N |
| XLogP | 2.56 |
| TPSA | 164.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.80 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|