C23H31N5O7S — CID 162648439
(2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-ethoxy-N-(2-methyl-5-sulfamoylphenyl)propanamide (PubChem CID 162648439) has the molecular formula C23H31N5O7S and a molecular weight of 521.60 g/mol. Its IUPAC name is (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-ethoxy-N-(2-methyl-5-sulfamoylphenyl)propanamide.
| Compound Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-ethoxy-N-(2-methyl-5-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 162648439 |
| Molecular Formula | C23H31N5O7S |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-3-ethoxy-N-(2-methyl-5-sulfamoylphenyl)propanamide |
| SMILES | CCOC[C@@H](/N=C(\N)NC(=O)Cc1ccc(OC)c(OC)c1)C(=O)Nc1cc(S(N)(=O)=O)ccc1C |
| InChI | InChI=1S/C23H31N5O7S/c1-5-35-13-18(22(30)26-17-12-16(36(25,31)32)8-6-14(17)2)27-23(24)28-21(29)11-15-7-9-19(33-3)20(10-15)34-4/h6-10,12,18H,5,11,13H2,1-4H3,(H,26,30)(H2,25,31,32)(H3,24,27,28,29)/t18-/m1/s1 |
| InChIKey | SVYKWSMAQYLXOQ-GOSISDBHSA-N |
| XLogP | 0.68 |
| TPSA | 184.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|