C23H48N4O7 — CID 123205902
4-(3-aminopentan-3-ylamino)-6-ethyl-2-methyl-6-(methylamino)-5-oxo-N-(2,3,4,5,6-pentahydroxyhexyl)octanamide (PubChem CID 123205902) has the molecular formula C23H48N4O7 and a molecular weight of 492.66 g/mol. Its IUPAC name is 4-(3-aminopentan-3-ylamino)-6-ethyl-2-methyl-6-(methylamino)-5-oxo-N-(2,3,4,5,6-pentahydroxyhexyl)octanamide.
| Compound Name | 4-(3-aminopentan-3-ylamino)-6-ethyl-2-methyl-6-(methylamino)-5-oxo-N-(2,3,4,5,6-pentahydroxyhexyl)octanamide |
|---|---|
| PubChem CID | 123205902 |
| Molecular Formula | C23H48N4O7 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.35 |
| IUPAC Name | 4-(3-aminopentan-3-ylamino)-6-ethyl-2-methyl-6-(methylamino)-5-oxo-N-(2,3,4,5,6-pentahydroxyhexyl)octanamide |
| SMILES | CCC(N)(CC)NC(CC(C)C(=O)NCC(O)C(O)C(O)C(O)CO)C(=O)C(CC)(CC)NC |
| InChI | InChI=1S/C23H48N4O7/c1-7-22(8-2,25-6)20(33)15(27-23(24,9-3)10-4)11-14(5)21(34)26-12-16(29)18(31)19(32)17(30)13-28/h14-19,25,27-32H,7-13,24H2,1-6H3,(H,26,34) |
| InChIKey | RNGDRUQTUQJJHC-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 197.40 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|