C26H34BN5O6 — CID 123449295
methyl N-[6,10-dioxo-4-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepin-7-yl]carbamate (PubChem CID 123449295) has the molecular formula C26H34BN5O6 and a molecular weight of 523.40 g/mol. Its IUPAC name is methyl N-[6,10-dioxo-4-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepin-7-yl]carbamate.
| Compound Name | methyl N-[6,10-dioxo-4-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepin-7-yl]carbamate |
|---|---|
| PubChem CID | 123449295 |
| Molecular Formula | C26H34BN5O6 |
| Molecular Weight | 523.40 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | methyl N-[6,10-dioxo-4-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepin-7-yl]carbamate |
| SMILES | COC(=O)NC1CCC(=O)N2CCCC(c3ncc(-c4ccc(B5OC(C)(C)C(C)(C)O5)cc4)[nH]3)N2C1=O |
| InChI | InChI=1S/C26H34BN5O6/c1-25(2)26(3,4)38-27(37-25)17-10-8-16(9-11-17)19-15-28-22(29-19)20-7-6-14-31-21(33)13-12-18(23(34)32(20)31)30-24(35)36-5/h8-11,15,18,20H,6-7,12-14H2,1-5H3,(H,28,29)(H,30,35) |
| InChIKey | DKCJQCVWUJWUKX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 126.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|