C29H33BN4O5 — CID 123872752
methyl N-[9-methyl-11-oxo-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-10-yl]carbamate (PubChem CID 123872752) has the molecular formula C29H33BN4O5 and a molecular weight of 528.42 g/mol. Its IUPAC name is methyl N-[9-methyl-11-oxo-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-10-yl]carbamate.
| Compound Name | methyl N-[9-methyl-11-oxo-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-10-yl]carbamate |
|---|---|
| PubChem CID | 123872752 |
| Molecular Formula | C29H33BN4O5 |
| Molecular Weight | 528.42 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | methyl N-[9-methyl-11-oxo-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-10-yl]carbamate |
| SMILES | COC(=O)NC1C(=O)N2c3c(cccc3C1C)CC2c1ncc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)[nH]1 |
| InChI | InChI=1S/C29H33BN4O5/c1-16-20-9-7-8-18-14-22(34(24(18)20)26(35)23(16)33-27(36)37-6)25-31-15-21(32-25)17-10-12-19(13-11-17)30-38-28(2,3)29(4,5)39-30/h7-13,15-16,22-23H,14H2,1-6H3,(H,31,32)(H,33,36) |
| InChIKey | IKWPDJBPDFZCSB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|